About 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide
4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide (PubChem CID 24662850) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide |
| PubChem CID | 24662850 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c2ncc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C18H22N4O2S/c1-12-16-10-14(11-19-17(16)22(5)20-12)21-25(23,24)15-8-6-13(7-9-15)18(2,3)4/h6-11,21H,1-5H3 |
| InChIKey | QSIBGVOQCIVHFM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide?
The IUPAC name of 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide (CID 24662850) is 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide.
What is the SMILES notation for 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide?
The canonical SMILES for 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide is Cc1nn(C)c2ncc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc12.
What is the InChIKey of 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide?
The InChIKey is QSIBGVOQCIVHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2S/c1-12-16-10-14(11-19-17(16)22(5)20-12)21-25(23,24)15-8-6-13(7-9-15)18(2,3)4/h6-11,21H,1-5H3.
What are the key properties of 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide?
4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide has a molecular weight of 358.47 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzenesulfonamide is sourced from PubChem (CID 24662850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).