C18H21ClN2O4S2 — CID 24663628
1-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 24663628) has the molecular formula C18H21ClN2O4S2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24663628 |
| Molecular Formula | C18H21ClN2O4S2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2CCCN2S(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C18H21ClN2O4S2/c1-25-14-6-4-13(5-7-14)10-11-20-18(22)15-3-2-12-21(15)27(23,24)17-9-8-16(19)26-17/h4-9,15H,2-3,10-12H2,1H3,(H,20,22) |
| InChIKey | CSOYDVNFCRPCIF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |