C13H12ClN3O3S — CID 2466542
ethyl 2-[2-[(6-chloropyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 2466542) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is ethyl 2-[2-[(6-chloropyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(6-chloropyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 2466542 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | ethyl 2-[2-[(6-chloropyridine-3-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C13H12ClN3O3S/c1-2-20-11(18)5-9-7-21-13(16-9)17-12(19)8-3-4-10(14)15-6-8/h3-4,6-7H,2,5H2,1H3,(H,16,17,19) |
| InChIKey | USQILVRCRJDPPT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|