C15H20NO5S- — CID 2466564
4-methoxy-3-[[(1R,2S)-2-methylcyclohexyl]sulfamoyl]benzoate (PubChem CID 2466564) has the molecular formula C15H20NO5S- and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-methoxy-3-[[(1R,2S)-2-methylcyclohexyl]sulfamoyl]benzoate.
| Compound Name | 4-methoxy-3-[[(1R,2S)-2-methylcyclohexyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2466564 |
| Molecular Formula | C15H20NO5S- |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-methoxy-3-[[(1R,2S)-2-methylcyclohexyl]sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)[O-])cc1S(=O)(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C15H21NO5S/c1-10-5-3-4-6-12(10)16-22(19,20)14-9-11(15(17)18)7-8-13(14)21-2/h7-10,12,16H,3-6H2,1-2H3,(H,17,18)/p-1/t10-,12+/m0/s1 |
| InChIKey | NNSQNEQHZXALFZ-CMPLNLGQSA-M |
| XLogP | 0.92 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |