About ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate
ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 2466640) has the molecular formula C22H20N2O5S
and a molecular weight of 424.48 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate |
| PubChem CID | 2466640 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)Cc2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-2-28-22(27)16-8-10-17(11-9-16)23-19(25)13-29-20(26)12-18-14-30-21(24-18)15-6-4-3-5-7-15/h3-11,14H,2,12-13H2,1H3,(H,23,25) |
| InChIKey | CUHBACLYTQFRMM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate?
The IUPAC name of ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate (CID 2466640) is ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate?
The canonical SMILES for ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate is CCOC(=O)c1ccc(NC(=O)COC(=O)Cc2csc(-c3ccccc3)n2)cc1.
What is the InChIKey of ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate?
The InChIKey is CUHBACLYTQFRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O5S/c1-2-28-22(27)16-8-10-17(11-9-16)23-19(25)13-29-20(26)12-18-14-30-21(24-18)15-6-4-3-5-7-15/h3-11,14H,2,12-13H2,1H3,(H,23,25).
What are the key properties of ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate?
ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate has a molecular weight of 424.48 g/mol, XLogP of 3.71, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2-[2-(2-phenyl-1,3-thiazol-4-yl)acetyl]oxyacetyl]amino]benzoate is sourced from PubChem (CID 2466640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).