C16H23N3O3S — CID 24666464
5-(cyclopropanecarbonylamino)-3-methyl-N-[2-(2-methylpropanoylamino)ethyl]thiophene-2-carboxamide (PubChem CID 24666464) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 5-(cyclopropanecarbonylamino)-3-methyl-N-[2-(2-methylpropanoylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-(cyclopropanecarbonylamino)-3-methyl-N-[2-(2-methylpropanoylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24666464 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-(cyclopropanecarbonylamino)-3-methyl-N-[2-(2-methylpropanoylamino)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2)sc1C(=O)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C16H23N3O3S/c1-9(2)14(20)17-6-7-18-16(22)13-10(3)8-12(23-13)19-15(21)11-4-5-11/h8-9,11H,4-7H2,1-3H3,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | VXWDMLQZQQUHDE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|