C22H27N5OS3 — CID 24667383
5-tert-butyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 24667383) has the molecular formula C22H27N5OS3 and a molecular weight of 473.69 g/mol. Its IUPAC name is 5-tert-butyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24667383 |
| Molecular Formula | C22H27N5OS3 |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 5-tert-butyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3cc4c(s3)CCC(C(C)(C)C)C4)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C22H27N5OS3/c1-6-9-27-18(25-26-21(27)29)17-12(2)23-20(31-17)24-19(28)16-11-13-10-14(22(3,4)5)7-8-15(13)30-16/h6,11,14H,1,7-10H2,2-5H3,(H,26,29)(H,23,24,28) |
| InChIKey | OUFZXGZAIPKABK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|