C20H22N6O3S2 — CID 24669216
N,N-diethyl-3-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 24669216) has the molecular formula C20H22N6O3S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N,N-diethyl-3-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | N,N-diethyl-3-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 24669216 |
| Molecular Formula | C20H22N6O3S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N,N-diethyl-3-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nnc(SCc3noc(-c4ccc(C)cc4)n3)n2c1 |
| InChI | InChI=1S/C20H22N6O3S2/c1-4-25(5-2)31(27,28)16-10-11-18-22-23-20(26(18)12-16)30-13-17-21-19(29-24-17)15-8-6-14(3)7-9-15/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | KMDDVQMJWNTVDY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 106.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |