About N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide
N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide (PubChem CID 24669676) has the molecular formula C18H16N4OS
and a molecular weight of 336.42 g/mol. Its IUPAC name is N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide |
| PubChem CID | 24669676 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide |
| SMILES | Cc1sc(-n2cccc2)c(C(=O)Nn2cnc3ccccc32)c1C |
| InChI | InChI=1S/C18H16N4OS/c1-12-13(2)24-18(21-9-5-6-10-21)16(12)17(23)20-22-11-19-14-7-3-4-8-15(14)22/h3-11H,1-2H3,(H,20,23) |
| InChIKey | RWZXLPPPWOHCOD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide?
The IUPAC name of N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide (CID 24669676) is N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide.
What is the SMILES notation for N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide?
The canonical SMILES for N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide is Cc1sc(-n2cccc2)c(C(=O)Nn2cnc3ccccc32)c1C.
What is the InChIKey of N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide?
The InChIKey is RWZXLPPPWOHCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4OS/c1-12-13(2)24-18(21-9-5-6-10-21)16(12)17(23)20-22-11-19-14-7-3-4-8-15(14)22/h3-11H,1-2H3,(H,20,23).
What are the key properties of N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide?
N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide has a molecular weight of 336.42 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzimidazol-1-yl)-4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide is sourced from PubChem (CID 24669676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).