C22H28ClN3O4S — CID 24669740
(E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(6-chloro-2H-chromen-3-yl)prop-2-en-1-one (PubChem CID 24669740) has the molecular formula C22H28ClN3O4S and a molecular weight of 466.00 g/mol. Its IUPAC name is (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(6-chloro-2H-chromen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(6-chloro-2H-chromen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24669740 |
| Molecular Formula | C22H28ClN3O4S |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-(6-chloro-2H-chromen-3-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/C1=Cc2cc(Cl)ccc2OC1)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C22H28ClN3O4S/c23-20-6-7-21-19(16-20)15-18(17-30-21)5-8-22(27)24-11-13-26(14-12-24)31(28,29)25-9-3-1-2-4-10-25/h5-8,15-16H,1-4,9-14,17H2/b8-5+ |
| InChIKey | HDXQRLDEOHOUFU-VMPITWQZSA-N |
| XLogP | 2.94 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|