About 1,1'-biphenyl;phenoxybenzene
1,1'-biphenyl;phenoxybenzene (PubChem CID 24670) has the molecular formula C24H20O
and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,1'-biphenyl;phenoxybenzene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;phenoxybenzene |
| PubChem CID | 24670 |
| Molecular Formula | C24H20O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1,1'-biphenyl;phenoxybenzene |
| SMILES | c1ccc(-c2ccccc2)cc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C12H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H;1-10H |
| InChIKey | MHCVCKDNQYMGEX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1'-biphenyl;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;phenoxybenzene?
The IUPAC name of 1,1'-biphenyl;phenoxybenzene (CID 24670) is 1,1'-biphenyl;phenoxybenzene.
What is the SMILES notation for 1,1'-biphenyl;phenoxybenzene?
The canonical SMILES for 1,1'-biphenyl;phenoxybenzene is c1ccc(-c2ccccc2)cc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;phenoxybenzene?
The InChIKey is MHCVCKDNQYMGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C12H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H;1-10H.
What are the key properties of 1,1'-biphenyl;phenoxybenzene?
1,1'-biphenyl;phenoxybenzene has a molecular weight of 324.42 g/mol, XLogP of 6.83, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;phenoxybenzene is sourced from PubChem (CID 24670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).