About 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one
1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 2467031) has the molecular formula C13H8F3N3O2S
and a molecular weight of 327.29 g/mol. Its IUPAC name is 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 2467031 |
| Molecular Formula | C13H8F3N3O2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C13H8F3N3O2S/c14-13(15,16)8-3-4-11(20)19(6-8)7-10-17-18-12(21-10)9-2-1-5-22-9/h1-6H,7H2 |
| InChIKey | OLXJFJJLNDBDPK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one (CID 2467031) is 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one is O=c1ccc(C(F)(F)F)cn1Cc1nnc(-c2cccs2)o1.
What is the InChIKey of 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is OLXJFJJLNDBDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3N3O2S/c14-13(15,16)8-3-4-11(20)19(6-8)7-10-17-18-12(21-10)9-2-1-5-22-9/h1-6H,7H2.
What are the key properties of 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one?
1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 327.29 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 2467031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).