C18H20N2S2 — CID 24671700
1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3,4-dimethylphenyl)thiourea (PubChem CID 24671700) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 24671700 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2CCSc3ccccc32)cc1C |
| InChI | InChI=1S/C18H20N2S2/c1-12-7-8-14(11-13(12)2)19-18(21)20-16-9-10-22-17-6-4-3-5-15(16)17/h3-8,11,16H,9-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | ARPHMXMCCZACNG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|