C14H15ClN4O2 — CID 24671907
N'-(2-chlorobenzoyl)-5-propyl-1H-pyrazole-3-carbohydrazide (PubChem CID 24671907) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-5-propyl-1H-pyrazole-3-carbohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-5-propyl-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 24671907 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N'-(2-chlorobenzoyl)-5-propyl-1H-pyrazole-3-carbohydrazide |
| SMILES | CCCc1cc(C(=O)NNC(=O)c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C14H15ClN4O2/c1-2-5-9-8-12(17-16-9)14(21)19-18-13(20)10-6-3-4-7-11(10)15/h3-4,6-8H,2,5H2,1H3,(H,16,17)(H,18,20)(H,19,21) |
| InChIKey | PNHHKSQDZTXABX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|