C21H29N3O3S — CID 24671977
N-[2-(diethylamino)-2-phenylethyl]-3-(ethylsulfonylamino)benzamide (PubChem CID 24671977) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-3-(ethylsulfonylamino)benzamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-3-(ethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 24671977 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-3-(ethylsulfonylamino)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1cccc(NS(=O)(=O)CC)c1)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-4-24(5-2)20(17-11-8-7-9-12-17)16-22-21(25)18-13-10-14-19(15-18)23-28(26,27)6-3/h7-15,20,23H,4-6,16H2,1-3H3,(H,22,25) |
| InChIKey | QKNFWLBTDUHKLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |