C20H25ClFN3O4S — CID 24674869
N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 24674869) has the molecular formula C20H25ClFN3O4S and a molecular weight of 457.96 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24674869 |
| Molecular Formula | C20H25ClFN3O4S |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NCC(c2c(F)cccc2Cl)N(C)C)cc1 |
| InChI | InChI=1S/C20H25ClFN3O4S/c1-25(2)18(19-16(21)5-4-6-17(19)22)13-23-20(26)14-7-9-15(10-8-14)30(27,28)24-11-12-29-3/h4-10,18,24H,11-13H2,1-3H3,(H,23,26) |
| InChIKey | UBOMILDLCNKUDV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|