About [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 2467632) has the molecular formula C19H21NO7
and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate |
| PubChem CID | 2467632 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21NO7/c1-5-26-18-13(7-6-8-20-18)19(22)27-11-14(21)12-9-15(23-2)17(25-4)16(10-12)24-3/h6-10H,5,11H2,1-4H3 |
| InChIKey | YWGOPEGGEGNDLS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate?
The IUPAC name of [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate (CID 2467632) is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate.
What is the SMILES notation for [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate?
The canonical SMILES for [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate is CCOc1ncccc1C(=O)OCC(=O)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate?
The InChIKey is YWGOPEGGEGNDLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO7/c1-5-26-18-13(7-6-8-20-18)19(22)27-11-14(21)12-9-15(23-2)17(25-4)16(10-12)24-3/h6-10H,5,11H2,1-4H3.
What are the key properties of [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate?
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate has a molecular weight of 375.38 g/mol, XLogP of 2.55, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 2-ethoxypyridine-3-carboxylate is sourced from PubChem (CID 2467632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).