C22H23N3O4S — CID 24676450
1-oxo-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]-2H-isoquinoline-3-carboxamide (PubChem CID 24676450) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-oxo-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]-2H-isoquinoline-3-carboxamide.
| Compound Name | 1-oxo-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 24676450 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-oxo-N-[(2-piperidin-1-ylsulfonylphenyl)methyl]-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(NCc1ccccc1S(=O)(=O)N1CCCCC1)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H23N3O4S/c26-21-18-10-4-2-8-16(18)14-19(24-21)22(27)23-15-17-9-3-5-11-20(17)30(28,29)25-12-6-1-7-13-25/h2-5,8-11,14H,1,6-7,12-13,15H2,(H,23,27)(H,24,26) |
| InChIKey | WCPACWYHHKMSGD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |