About (2-fluorophenyl)methyl 4-methylsulfonylbenzoate
(2-fluorophenyl)methyl 4-methylsulfonylbenzoate (PubChem CID 2467717) has the molecular formula C15H13FO4S
and a molecular weight of 308.33 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 4-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 4-methylsulfonylbenzoate |
| PubChem CID | 2467717 |
| Molecular Formula | C15H13FO4S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (2-fluorophenyl)methyl 4-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C15H13FO4S/c1-21(18,19)13-8-6-11(7-9-13)15(17)20-10-12-4-2-3-5-14(12)16/h2-9H,10H2,1H3 |
| InChIKey | MGCLFFJJFJMZGX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-fluorophenyl)methyl 4-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 4-methylsulfonylbenzoate?
The IUPAC name of (2-fluorophenyl)methyl 4-methylsulfonylbenzoate (CID 2467717) is (2-fluorophenyl)methyl 4-methylsulfonylbenzoate.
What is the SMILES notation for (2-fluorophenyl)methyl 4-methylsulfonylbenzoate?
The canonical SMILES for (2-fluorophenyl)methyl 4-methylsulfonylbenzoate is CS(=O)(=O)c1ccc(C(=O)OCc2ccccc2F)cc1.
What is the InChIKey of (2-fluorophenyl)methyl 4-methylsulfonylbenzoate?
The InChIKey is MGCLFFJJFJMZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO4S/c1-21(18,19)13-8-6-11(7-9-13)15(17)20-10-12-4-2-3-5-14(12)16/h2-9H,10H2,1H3.
What are the key properties of (2-fluorophenyl)methyl 4-methylsulfonylbenzoate?
(2-fluorophenyl)methyl 4-methylsulfonylbenzoate has a molecular weight of 308.33 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 4-methylsulfonylbenzoate is sourced from PubChem (CID 2467717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).