C24H28N2O6 — CID 24677736
[2-[2-[[2-(3,5-dimethylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 3,5-dimethylbenzoate (PubChem CID 24677736) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-[2-[[2-(3,5-dimethylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 3,5-dimethylbenzoate.
| Compound Name | [2-[2-[[2-(3,5-dimethylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 24677736 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [2-[2-[[2-(3,5-dimethylbenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(=O)NCCNC(=O)COC(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C24H28N2O6/c1-15-7-16(2)10-19(9-15)23(29)31-13-21(27)25-5-6-26-22(28)14-32-24(30)20-11-17(3)8-18(4)12-20/h7-12H,5-6,13-14H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | MKWLKEAKEUHZEY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|