C17H21ClN4O5 — CID 24677761
[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 24677761) has the molecular formula C17H21ClN4O5 and a molecular weight of 396.83 g/mol. Its IUPAC name is [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 24677761 |
| Molecular Formula | C17H21ClN4O5 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OC(C)C(=O)Nc2ccc(Cl)cn2)C1=O |
| InChI | InChI=1S/C17H21ClN4O5/c1-4-17(5-2)15(25)22(16(26)21-17)9-13(23)27-10(3)14(24)20-12-7-6-11(18)8-19-12/h6-8,10H,4-5,9H2,1-3H3,(H,21,26)(H,19,20,24) |
| InChIKey | DMBAMTCPEIVEDK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|