C15H12F2N2O2S — CID 24679084
4-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylbenzenesulfonamide (PubChem CID 24679084) has the molecular formula C15H12F2N2O2S and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 24679084 |
| Molecular Formula | C15H12F2N2O2S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-cyano-N-[(3,4-difluorophenyl)methyl]-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1ccc(F)c(F)c1)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H12F2N2O2S/c1-19(10-12-4-7-14(16)15(17)8-12)22(20,21)13-5-2-11(9-18)3-6-13/h2-8H,10H2,1H3 |
| InChIKey | BSPNRLJLJBEPIQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |