C18H27N5O2 — CID 24680586
4-[[2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile (PubChem CID 24680586) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 4-[[2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile.
| Compound Name | 4-[[2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 24680586 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 4-[[2-[bis(prop-2-enyl)amino]-3-methylbutyl]amino]-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonitrile |
| SMILES | C=CCN(CC=C)C(CNc1c(C#N)c(=O)n(C)c(=O)n1C)C(C)C |
| InChI | InChI=1S/C18H27N5O2/c1-7-9-23(10-8-2)15(13(3)4)12-20-16-14(11-19)17(24)22(6)18(25)21(16)5/h7-8,13,15,20H,1-2,9-10,12H2,3-6H3 |
| InChIKey | PYQIBAFQFLAMEL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|