sulfur trioxide

O3S — CID 24682

IUPACsulfur trioxide
SMILESO=S(=O)=O
InChIInChI=1S/O3S/c1-4(2)3
InChIKeyAKEJUJNQAAGONA-UHFFFAOYSA-N
MW80.06 g/mol
LogP-1.00
Rot. Bonds

About sulfur trioxide

sulfur trioxide (PubChem CID 24682) has the molecular formula O3S and a molecular weight of 80.06 g/mol. Its IUPAC name is sulfur trioxide.

Molecular Properties

Compound Namesulfur trioxide
PubChem CID24682
Molecular FormulaO3S
Molecular Weight80.06 g/mol
Exact Mass79.96
IUPAC Namesulfur trioxide
SMILESO=S(=O)=O
InChIInChI=1S/O3S/c1-4(2)3
InChIKeyAKEJUJNQAAGONA-UHFFFAOYSA-N
XLogP-1.00
TPSA51.21 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50080.06
LogP ≤ 5-1.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze sulfur trioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfur trioxide?
The IUPAC name of sulfur trioxide (CID 24682) is sulfur trioxide.
What is the SMILES notation for sulfur trioxide?
The canonical SMILES for sulfur trioxide is O=S(=O)=O.
What is the InChIKey of sulfur trioxide?
The InChIKey is AKEJUJNQAAGONA-UHFFFAOYSA-N. The full InChI is InChI=1S/O3S/c1-4(2)3.
What are the key properties of sulfur trioxide?
sulfur trioxide has a molecular weight of 80.06 g/mol, XLogP of -1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur trioxide is sourced from PubChem (CID 24682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).