About 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (PubChem CID 2468237) has the molecular formula C6H6NO3S-
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| PubChem CID | 2468237 |
| Molecular Formula | C6H6NO3S- |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate |
| SMILES | Cc1csc(=O)n1CC(=O)[O-] |
| InChI | InChI=1S/C6H7NO3S/c1-4-3-11-6(10)7(4)2-5(8)9/h3H,2H2,1H3,(H,8,9)/p-1 |
| InChIKey | RUXSNFPDNUJKLO-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The IUPAC name of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate (CID 2468237) is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate.
What is the SMILES notation for 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The canonical SMILES for 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate is Cc1csc(=O)n1CC(=O)[O-].
What is the InChIKey of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
The InChIKey is RUXSNFPDNUJKLO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3S/c1-4-3-11-6(10)7(4)2-5(8)9/h3H,2H2,1H3,(H,8,9)/p-1.
What are the key properties of 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate?
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate has a molecular weight of 172.19 g/mol, XLogP of -1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetate is sourced from PubChem (CID 2468237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).