C18H20N2S3 — CID 2468292
(4S)-8-(1,3-dithian-2-ylidene)-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 2468292) has the molecular formula C18H20N2S3 and a molecular weight of 360.57 g/mol. Its IUPAC name is (4S)-8-(1,3-dithian-2-ylidene)-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | (4S)-8-(1,3-dithian-2-ylidene)-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 2468292 |
| Molecular Formula | C18H20N2S3 |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (4S)-8-(1,3-dithian-2-ylidene)-4-phenyl-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | S=C1NC2=C(CCCC2=C2SCCCS2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C18H20N2S3/c21-18-19-15(12-6-2-1-3-7-12)13-8-4-9-14(16(13)20-18)17-22-10-5-11-23-17/h1-3,6-7,15H,4-5,8-11H2,(H2,19,20,21)/t15-/m0/s1 |
| InChIKey | JWZHTJMCSZBAJI-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|