C23H23N3O3 — CID 24682928
6-(4-benzoylpiperidine-1-carbonyl)-2-phenyl-4,5-dihydropyridazin-3-one (PubChem CID 24682928) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is 6-(4-benzoylpiperidine-1-carbonyl)-2-phenyl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(4-benzoylpiperidine-1-carbonyl)-2-phenyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 24682928 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 6-(4-benzoylpiperidine-1-carbonyl)-2-phenyl-4,5-dihydropyridazin-3-one |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)C2=NN(c3ccccc3)C(=O)CC2)CC1 |
| InChI | InChI=1S/C23H23N3O3/c27-21-12-11-20(24-26(21)19-9-5-2-6-10-19)23(29)25-15-13-18(14-16-25)22(28)17-7-3-1-4-8-17/h1-10,18H,11-16H2 |
| InChIKey | OVUWJYZAJQMCEP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |