C21H23N3O6S — CID 24683473
N-[2-[[2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]furan-2-carboxamide (PubChem CID 24683473) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[2-[[2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24683473 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[2-[[2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]acetyl]amino]ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCNC(=O)c2ccco2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c1-16-6-8-18(9-7-16)31(27,28)24(14-17-4-2-12-29-17)15-20(25)22-10-11-23-21(26)19-5-3-13-30-19/h2-9,12-13H,10-11,14-15H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | NWGDZZCEAQCPAM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|