About N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide
N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 2468349) has the molecular formula C11H9ClN2OS
and a molecular weight of 252.73 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 2468349 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C11H9ClN2OS/c1-7(15)13-11-14-10(6-16-11)8-3-2-4-9(12)5-8/h2-6H,1H3,(H,13,14,15) |
| InChIKey | KZZSOJLRLIMWLV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide (CID 2468349) is N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(-c2cccc(Cl)c2)cs1.
What is the InChIKey of N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is KZZSOJLRLIMWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2OS/c1-7(15)13-11-14-10(6-16-11)8-3-2-4-9(12)5-8/h2-6H,1H3,(H,13,14,15).
What are the key properties of N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide?
N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 252.73 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 2468349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).