C24H18N2O4 — CID 24683836
(2-oxo-1,2-diphenylethyl) 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 24683836) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 24683836 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)OC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18N2O4/c27-21(15-26-16-25-20-14-8-7-13-19(20)24(26)29)30-23(18-11-5-2-6-12-18)22(28)17-9-3-1-4-10-17/h1-14,16,23H,15H2 |
| InChIKey | BDQFZZXSYSGGOB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |