C15H13ClF3N3OS — CID 24684643
[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 24684643) has the molecular formula C15H13ClF3N3OS and a molecular weight of 375.80 g/mol. Its IUPAC name is [4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 24684643 |
| Molecular Formula | C15H13ClF3N3OS |
| Molecular Weight | 375.80 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | [4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C15H13ClF3N3OS/c16-11-8-10(15(17,18)19)9-20-13(11)21-3-5-22(6-4-21)14(23)12-2-1-7-24-12/h1-2,7-9H,3-6H2 |
| InChIKey | NAVYRGDMQNLYMM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |