C13H13Cl2N3O3 — CID 2468467
2,4-dichloro-N-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]benzamide (PubChem CID 2468467) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2468467 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2,4-dichloro-N-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]benzamide |
| SMILES | O=C1CN(C(=O)CNC(=O)c2ccc(Cl)cc2Cl)CCN1 |
| InChI | InChI=1S/C13H13Cl2N3O3/c14-8-1-2-9(10(15)5-8)13(21)17-6-12(20)18-4-3-16-11(19)7-18/h1-2,5H,3-4,6-7H2,(H,16,19)(H,17,21) |
| InChIKey | YRSIJTCYYSPLGU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |