About (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate
(1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (PubChem CID 24684697) has the molecular formula C17H19N3O3S
and a molecular weight of 345.42 g/mol. Its IUPAC name is (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
Molecular Properties
| Compound Name | (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| PubChem CID | 24684697 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(C)nc(SCC(=O)OC(C)C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H19N3O3S/c1-11-9-12(2)19-17(18-11)24-10-15(21)23-13(3)16(22)20-14-7-5-4-6-8-14/h4-9,13H,10H2,1-3H3,(H,20,22) |
| InChIKey | GLLKKHDKCBBKLW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
The IUPAC name of (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (CID 24684697) is (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
What is the SMILES notation for (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
The canonical SMILES for (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate is Cc1cc(C)nc(SCC(=O)OC(C)C(=O)Nc2ccccc2)n1.
What is the InChIKey of (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
The InChIKey is GLLKKHDKCBBKLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3S/c1-11-9-12(2)19-17(18-11)24-10-15(21)23-13(3)16(22)20-14-7-5-4-6-8-14/h4-9,13H,10H2,1-3H3,(H,20,22).
What are the key properties of (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate?
(1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate has a molecular weight of 345.42 g/mol, XLogP of 2.76, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-anilino-1-oxopropan-2-yl) 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate is sourced from PubChem (CID 24684697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).