About propan-2-yl N-phenylcarbamate
propan-2-yl N-phenylcarbamate (PubChem CID 24685) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is propan-2-yl N-phenylcarbamate.
Molecular Properties
| Compound Name | propan-2-yl N-phenylcarbamate |
| PubChem CID | 24685 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | propan-2-yl N-phenylcarbamate |
| SMILES | CC(C)OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12) |
| InChIKey | VXPLXMJHHKHSOA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-phenylcarbamate?
The IUPAC name of propan-2-yl N-phenylcarbamate (CID 24685) is propan-2-yl N-phenylcarbamate.
What is the SMILES notation for propan-2-yl N-phenylcarbamate?
The canonical SMILES for propan-2-yl N-phenylcarbamate is CC(C)OC(=O)Nc1ccccc1.
What is the InChIKey of propan-2-yl N-phenylcarbamate?
The InChIKey is VXPLXMJHHKHSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12).
What are the key properties of propan-2-yl N-phenylcarbamate?
propan-2-yl N-phenylcarbamate has a molecular weight of 179.22 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-phenylcarbamate is sourced from PubChem (CID 24685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).