C16H23Cl2N3O3S — CID 24685339
2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide (PubChem CID 24685339) has the molecular formula C16H23Cl2N3O3S and a molecular weight of 408.35 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 24685339 |
| Molecular Formula | C16H23Cl2N3O3S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H23Cl2N3O3S/c1-3-20(4-2)16(22)12-19-7-9-21(10-8-19)25(23,24)13-5-6-14(17)15(18)11-13/h5-6,11H,3-4,7-10,12H2,1-2H3 |
| InChIKey | SDVHEINVNKBXEW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |