C18H22N2O4 — CID 24685423
butyl 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetate (PubChem CID 24685423) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is butyl 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetate.
| Compound Name | butyl 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetate |
|---|---|
| PubChem CID | 24685423 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | butyl 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)acetate |
| SMILES | CCCCOC(=O)CN1C(=O)NC2(CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C18H22N2O4/c1-2-3-11-24-15(21)12-20-16(22)18(19-17(20)23)10-6-8-13-7-4-5-9-14(13)18/h4-5,7,9H,2-3,6,8,10-12H2,1H3,(H,19,23) |
| InChIKey | YNPXFYBASHKXGO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|