C15H15F3N2OS — CID 24685979
2-[methyl(thiophen-2-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 24685979) has the molecular formula C15H15F3N2OS and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-[methyl(thiophen-2-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 24685979 |
| Molecular Formula | C15H15F3N2OS |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[methyl(thiophen-2-ylmethyl)amino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(F)c(F)c1F)N(C)Cc1cccs1 |
| InChI | InChI=1S/C15H15F3N2OS/c1-9(20(2)8-10-4-3-7-22-10)15(21)19-12-6-5-11(16)13(17)14(12)18/h3-7,9H,8H2,1-2H3,(H,19,21) |
| InChIKey | MDNCORLJMQCMFK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|