C14H13F3N2O4 — CID 24686035
N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 24686035) has the molecular formula C14H13F3N2O4 and a molecular weight of 330.26 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 24686035 |
| Molecular Formula | C14H13F3N2O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C1=COCCO1 |
| InChI | InChI=1S/C14H13F3N2O4/c1-19(14(21)10-7-22-4-5-23-10)6-11(20)18-9-3-2-8(15)12(16)13(9)17/h2-3,7H,4-6H2,1H3,(H,18,20) |
| InChIKey | SMBCLICDRCBRTF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|