About [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate
[1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate (PubChem CID 24686057) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate |
| PubChem CID | 24686057 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)C(C)OC(=O)c2ccccn2)cc1C |
| InChI | InChI=1S/C18H19NO3/c1-11-9-13(3)15(10-12(11)2)17(20)14(4)22-18(21)16-7-5-6-8-19-16/h5-10,14H,1-4H3 |
| InChIKey | DXJDQKRNPUURNE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate?
The IUPAC name of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate (CID 24686057) is [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate.
What is the SMILES notation for [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate?
The canonical SMILES for [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate is Cc1cc(C)c(C(=O)C(C)OC(=O)c2ccccn2)cc1C.
What is the InChIKey of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate?
The InChIKey is DXJDQKRNPUURNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-11-9-13(3)15(10-12(11)2)17(20)14(4)22-18(21)16-7-5-6-8-19-16/h5-10,14H,1-4H3.
What are the key properties of [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate?
[1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate has a molecular weight of 297.35 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] pyridine-2-carboxylate is sourced from PubChem (CID 24686057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).