About [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 24686077) has the molecular formula C12H12Cl2N2O3
and a molecular weight of 303.14 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate |
| PubChem CID | 24686077 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | O=C(COC(=O)C1CCC1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3/c13-8-4-9(14)11(15-5-8)16-10(17)6-19-12(18)7-2-1-3-7/h4-5,7H,1-3,6H2,(H,15,16,17) |
| InChIKey | XIKVYGNGVIUJGP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate (CID 24686077) is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate is O=C(COC(=O)C1CCC1)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate?
The InChIKey is XIKVYGNGVIUJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O3/c13-8-4-9(14)11(15-5-8)16-10(17)6-19-12(18)7-2-1-3-7/h4-5,7H,1-3,6H2,(H,15,16,17).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate?
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate has a molecular weight of 303.14 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclobutanecarboxylate is sourced from PubChem (CID 24686077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).