About [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate (PubChem CID 24686154) has the molecular formula C17H15ClN2O3
and a molecular weight of 330.77 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
| PubChem CID | 24686154 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1ccc(Cl)nc1)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H15ClN2O3/c1-11(23-17(22)13-6-7-15(18)19-10-13)16(21)20-9-8-12-4-2-3-5-14(12)20/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | ZUODKSNSLSQAKP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate?
The IUPAC name of [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate (CID 24686154) is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate.
What is the SMILES notation for [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate?
The canonical SMILES for [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate is CC(OC(=O)c1ccc(Cl)nc1)C(=O)N1CCc2ccccc21.
What is the InChIKey of [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate?
The InChIKey is ZUODKSNSLSQAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O3/c1-11(23-17(22)13-6-7-15(18)19-10-13)16(21)20-9-8-12-4-2-3-5-14(12)20/h2-7,10-11H,8-9H2,1H3.
What are the key properties of [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate?
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate has a molecular weight of 330.77 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 6-chloropyridine-3-carboxylate is sourced from PubChem (CID 24686154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).