About benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate
benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 24686238) has the molecular formula C21H25NO4S
and a molecular weight of 387.50 g/mol. Its IUPAC name is benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate |
| PubChem CID | 24686238 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)OCc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C21H25NO4S/c1-16-8-9-20(14-17(16)2)27(24,25)22-12-10-19(11-13-22)21(23)26-15-18-6-4-3-5-7-18/h3-9,14,19H,10-13,15H2,1-2H3 |
| InChIKey | NQRCZWPLRODMBT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The IUPAC name of benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate (CID 24686238) is benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate.
What is the SMILES notation for benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The canonical SMILES for benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate is Cc1ccc(S(=O)(=O)N2CCC(C(=O)OCc3ccccc3)CC2)cc1C.
What is the InChIKey of benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The InChIKey is NQRCZWPLRODMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO4S/c1-16-8-9-20(14-17(16)2)27(24,25)22-12-10-19(11-13-22)21(23)26-15-18-6-4-3-5-7-18/h3-9,14,19H,10-13,15H2,1-2H3.
What are the key properties of benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate has a molecular weight of 387.50 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate is sourced from PubChem (CID 24686238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).