C17H22BrNO5S — CID 24686312
2-(4-bromo-2-formylphenoxy)-N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 24686312) has the molecular formula C17H22BrNO5S and a molecular weight of 432.34 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 24686312 |
| Molecular Formula | C17H22BrNO5S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CCC(C)N(C(=O)COc1ccc(Br)cc1C=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22BrNO5S/c1-3-12(2)19(15-6-7-25(22,23)11-15)17(21)10-24-16-5-4-14(18)8-13(16)9-20/h4-5,8-9,12,15H,3,6-7,10-11H2,1-2H3 |
| InChIKey | IQMNHOPLSIPFMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|