About [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate
[1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate (PubChem CID 24686379) has the molecular formula C14H15Cl2NO3
and a molecular weight of 316.18 g/mol. Its IUPAC name is [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate.
Molecular Properties
| Compound Name | [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate |
| PubChem CID | 24686379 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate |
| SMILES | CC(OC(=O)C1CCC1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-8(20-14(19)9-3-2-4-9)13(18)17-12-6-10(15)5-11(16)7-12/h5-9H,2-4H2,1H3,(H,17,18) |
| InChIKey | QJWYTAZKFWDBPI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate?
The IUPAC name of [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate (CID 24686379) is [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate.
What is the SMILES notation for [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate?
The canonical SMILES for [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate is CC(OC(=O)C1CCC1)C(=O)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate?
The InChIKey is QJWYTAZKFWDBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c1-8(20-14(19)9-3-2-4-9)13(18)17-12-6-10(15)5-11(16)7-12/h5-9H,2-4H2,1H3,(H,17,18).
What are the key properties of [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate?
[1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate has a molecular weight of 316.18 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-dichloroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate is sourced from PubChem (CID 24686379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).