About (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate
(5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 24686803) has the molecular formula C21H25NO7S
and a molecular weight of 435.50 g/mol. Its IUPAC name is (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate |
| PubChem CID | 24686803 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)C2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)o1 |
| InChI | InChI=1S/C21H25NO7S/c1-14-4-6-18(12-15(14)2)30(25,26)22-10-8-16(9-11-22)20(23)28-13-17-5-7-19(29-17)21(24)27-3/h4-7,12,16H,8-11,13H2,1-3H3 |
| InChIKey | FVLIJWVNDLWSCN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The IUPAC name of (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate (CID 24686803) is (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate.
What is the SMILES notation for (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The canonical SMILES for (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate is COC(=O)c1ccc(COC(=O)C2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)o1.
What is the InChIKey of (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
The InChIKey is FVLIJWVNDLWSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO7S/c1-14-4-6-18(12-15(14)2)30(25,26)22-10-8-16(9-11-22)20(23)28-13-17-5-7-19(29-17)21(24)27-3/h4-7,12,16H,8-11,13H2,1-3H3.
What are the key properties of (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate?
(5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate has a molecular weight of 435.50 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxycarbonylfuran-2-yl)methyl 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylate is sourced from PubChem (CID 24686803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).