C20H23N5O5S — CID 24686845
2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24686845) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24686845 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)CN2C(=O)NC3(CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C20H23N5O5S/c21-13-15-5-1-2-6-16(15)31(29,30)24-11-9-23(10-12-24)17(26)14-25-18(27)20(22-19(25)28)7-3-4-8-20/h1-2,5-6H,3-4,7-12,14H2,(H,22,28) |
| InChIKey | KLYCKSFNKLWNLI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|