About N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide
N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide (PubChem CID 24686952) has the molecular formula C20H27ClN4O4
and a molecular weight of 422.91 g/mol. Its IUPAC name is N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide.
Molecular Properties
| Compound Name | N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide |
| PubChem CID | 24686952 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide |
| SMILES | CCCCN(C(=O)C(C)Oc1cccc(Cl)c1)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H27ClN4O4/c1-4-6-11-24(16-17(22)25(10-5-2)20(28)23-18(16)26)19(27)13(3)29-15-9-7-8-14(21)12-15/h7-9,12-13H,4-6,10-11,22H2,1-3H3,(H,23,26,28) |
| InChIKey | QBUBVZFRVKPXIT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide?
The IUPAC name of N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide (CID 24686952) is N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide.
What is the SMILES notation for N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide?
The canonical SMILES for N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide is CCCCN(C(=O)C(C)Oc1cccc(Cl)c1)c1c(N)n(CCC)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide?
The InChIKey is QBUBVZFRVKPXIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27ClN4O4/c1-4-6-11-24(16-17(22)25(10-5-2)20(28)23-18(16)26)19(27)13(3)29-15-9-7-8-14(21)12-15/h7-9,12-13H,4-6,10-11,22H2,1-3H3,(H,23,26,28).
What are the key properties of N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide?
N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide has a molecular weight of 422.91 g/mol, XLogP of 2.78, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-2-(3-chlorophenoxy)propanamide is sourced from PubChem (CID 24686952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).