C12H10Cl4N2O3 — CID 24687052
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 24687052) has the molecular formula C12H10Cl4N2O3 and a molecular weight of 372.04 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 24687052 |
| Molecular Formula | C12H10Cl4N2O3 |
| Molecular Weight | 372.04 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C12H10Cl4N2O3/c1-11(5-12(11,15)16)10(20)21-4-8(19)18-9-7(14)2-6(13)3-17-9/h2-3H,4-5H2,1H3,(H,17,18,19) |
| InChIKey | VJKFZNVDZQWLAV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.04 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|