C21H27N5O5 — CID 24687223
N-[2-(4-acetamidoanilino)-2-oxoethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-ethylacetamide (PubChem CID 24687223) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[2-(4-acetamidoanilino)-2-oxoethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-ethylacetamide.
| Compound Name | N-[2-(4-acetamidoanilino)-2-oxoethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 24687223 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[2-(4-acetamidoanilino)-2-oxoethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-ethylacetamide |
| SMILES | CCN(CC(=O)Nc1ccc(NC(C)=O)cc1)C(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C21H27N5O5/c1-3-25(12-17(28)23-16-8-6-15(7-9-16)22-14(2)27)18(29)13-26-19(30)21(24-20(26)31)10-4-5-11-21/h6-9H,3-5,10-13H2,1-2H3,(H,22,27)(H,23,28)(H,24,31) |
| InChIKey | CQKYBIJBZPEGNE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|