About [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate (PubChem CID 24687288) has the molecular formula C15H13N3O6S
and a molecular weight of 363.35 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate |
| PubChem CID | 24687288 |
| Molecular Formula | C15H13N3O6S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCC(=O)NNC(=O)c2cccs2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O6S/c1-9-7-10(4-5-11(9)18(22)23)15(21)24-8-13(19)16-17-14(20)12-3-2-6-25-12/h2-7H,8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | OMVYNRFXVKLBPI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate?
The IUPAC name of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate (CID 24687288) is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate.
What is the SMILES notation for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate?
The canonical SMILES for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate is Cc1cc(C(=O)OCC(=O)NNC(=O)c2cccs2)ccc1[N+](=O)[O-].
What is the InChIKey of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate?
The InChIKey is OMVYNRFXVKLBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O6S/c1-9-7-10(4-5-11(9)18(22)23)15(21)24-8-13(19)16-17-14(20)12-3-2-6-25-12/h2-7H,8H2,1H3,(H,16,19)(H,17,20).
What are the key properties of [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate?
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate has a molecular weight of 363.35 g/mol, XLogP of 1.58, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-methyl-4-nitrobenzoate is sourced from PubChem (CID 24687288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).